C33H30N2O6S — CID 4999970
methyl 5-[[2-methoxy-4-[[4-oxo-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylate (PubChem CID 4999970) has the molecular formula C33H30N2O6S and a molecular weight of 582.68 g/mol. Its IUPAC name is methyl 5-[[2-methoxy-4-[[4-oxo-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylate.
| Compound Name | methyl 5-[[2-methoxy-4-[[4-oxo-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 4999970 |
| Molecular Formula | C33H30N2O6S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.18 |
| IUPAC Name | methyl 5-[[2-methoxy-4-[[4-oxo-2-phenylimino-3-(3-phenylpropyl)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(COc2ccc(C=C3S/C(=N\c4ccccc4)N(CCCc4ccccc4)C3=O)cc2OC)o1 |
| InChI | InChI=1S/C33H30N2O6S/c1-38-29-20-24(15-17-27(29)40-22-26-16-18-28(41-26)32(37)39-2)21-30-31(36)35(19-9-12-23-10-5-3-6-11-23)33(42-30)34-25-13-7-4-8-14-25/h3-8,10-11,13-18,20-21H,9,12,19,22H2,1-2H3/b30-21?,34-33- |
| InChIKey | IVVYHQKAFOFCHW-VMSLGFFUSA-N |
| XLogP | 6.89 |
| TPSA | 90.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|