C28H27N3O7S — CID 126391637
5-[[2-methoxy-4-[(Z)-[3-methyl-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126391637) has the molecular formula C28H27N3O7S and a molecular weight of 549.61 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[(Z)-[3-methyl-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxy-4-[(Z)-[3-methyl-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126391637 |
| Molecular Formula | C28H27N3O7S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.16 |
| IUPAC Name | 5-[[2-methoxy-4-[(Z)-[3-methyl-2-(4-morpholin-4-ylphenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\S/C(=N/c3ccc(N4CCOCC4)cc3)N(C)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C28H27N3O7S/c1-30-26(32)25(39-28(30)29-19-4-6-20(7-5-19)31-11-13-36-14-12-31)16-18-3-9-22(24(15-18)35-2)37-17-21-8-10-23(38-21)27(33)34/h3-10,15-16H,11-14,17H2,1-2H3,(H,33,34)/b25-16-,29-28+ |
| InChIKey | ZJLWCWNIYODKNT-PDSYLDJCSA-N |
| XLogP | 4.64 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|