C19H18N2O6S — CID 124549584
5-[[2-methoxy-4-[(Z)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid (PubChem CID 124549584) has the molecular formula C19H18N2O6S and a molecular weight of 402.43 g/mol. Its IUPAC name is 5-[[2-methoxy-4-[(Z)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-methoxy-4-[(Z)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 124549584 |
| Molecular Formula | C19H18N2O6S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 5-[[2-methoxy-4-[(Z)-(3-methyl-2-methylimino-4-oxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]methyl]furan-2-carboxylic acid |
| SMILES | C/N=C1/S/C(=C\c2ccc(OCc3ccc(C(=O)O)o3)c(OC)c2)C(=O)N1C |
| InChI | InChI=1S/C19H18N2O6S/c1-20-19-21(2)17(22)16(28-19)9-11-4-6-13(15(8-11)25-3)26-10-12-5-7-14(27-12)18(23)24/h4-9H,10H2,1-3H3,(H,23,24)/b16-9-,20-19+ |
| InChIKey | DCCUXTSCVRSDTM-DCVQPNPVSA-N |
| XLogP | 3.10 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|