C25H19BrN2O8S — CID 126391309
5-[[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126391309) has the molecular formula C25H19BrN2O8S and a molecular weight of 587.40 g/mol. Its IUPAC name is 5-[[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126391309 |
| Molecular Formula | C25H19BrN2O8S |
| Molecular Weight | 587.40 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 5-[[4-[(Z)-[3-[2-(4-bromoanilino)-2-oxoethyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\SC(=O)N(CC(=O)Nc3ccc(Br)cc3)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C25H19BrN2O8S/c1-34-20-10-14(2-8-18(20)35-13-17-7-9-19(36-17)24(31)32)11-21-23(30)28(25(33)37-21)12-22(29)27-16-5-3-15(26)4-6-16/h2-11H,12-13H2,1H3,(H,27,29)(H,31,32)/b21-11- |
| InChIKey | XGPDAEYJUXRAQH-NHDPSOOVSA-N |
| XLogP | 5.00 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.40 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|