C25H20BrN3O8 — CID 126389957
5-[[4-[(Z)-[1-[2-(4-bromoanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid (PubChem CID 126389957) has the molecular formula C25H20BrN3O8 and a molecular weight of 570.35 g/mol. Its IUPAC name is 5-[[4-[(Z)-[1-[2-(4-bromoanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[4-[(Z)-[1-[2-(4-bromoanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 126389957 |
| Molecular Formula | C25H20BrN3O8 |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 569.04 |
| IUPAC Name | 5-[[4-[(Z)-[1-[2-(4-bromoanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-methoxyphenoxy]methyl]furan-2-carboxylic acid |
| SMILES | COc1cc(/C=C2\NC(=O)N(CC(=O)Nc3ccc(Br)cc3)C2=O)ccc1OCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C25H20BrN3O8/c1-35-21-11-14(2-8-19(21)36-13-17-7-9-20(37-17)24(32)33)10-18-23(31)29(25(34)28-18)12-22(30)27-16-5-3-15(26)4-6-16/h2-11H,12-13H2,1H3,(H,27,30)(H,28,34)(H,32,33)/b18-10- |
| InChIKey | KQHXTSSBTUSTJN-ZDLGFXPLSA-N |
| XLogP | 3.86 |
| TPSA | 147.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|