C27H24IN3O6 — CID 126229198
2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126229198) has the molecular formula C27H24IN3O6 and a molecular weight of 613.41 g/mol. Its IUPAC name is 2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126229198 |
| Molecular Formula | C27H24IN3O6 |
| Molecular Weight | 613.41 g/mol |
| Exact Mass | 613.07 |
| IUPAC Name | 2-[(4E)-4-[[4-[(4-iodophenyl)methoxy]-3-methoxyphenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(OCc3ccc(I)cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C27H24IN3O6/c1-35-22-6-4-3-5-20(22)29-25(32)15-31-26(33)21(30-27(31)34)13-18-9-12-23(24(14-18)36-2)37-16-17-7-10-19(28)11-8-17/h3-14H,15-16H2,1-2H3,(H,29,32)(H,30,34)/b21-13+ |
| InChIKey | YJHDLIRIHQDFRA-FYJGNVAPSA-N |
| XLogP | 4.42 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.41 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|