C20H19N3O6 — CID 126244729
2-[(4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126244729) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126244729 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-[(4E)-4-[(4-hydroxy-3-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)ccc1O |
| InChI | InChI=1S/C20H19N3O6/c1-28-16-6-4-3-5-13(16)21-18(25)11-23-19(26)14(22-20(23)27)9-12-7-8-15(24)17(10-12)29-2/h3-10,24H,11H2,1-2H3,(H,21,25)(H,22,27)/b14-9+ |
| InChIKey | KZSJWPSLFOHJFR-NTEUORMPSA-N |
| XLogP | 1.94 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|