C23H23N3O8 — CID 126234651
2-[2-ethoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126234651) has the molecular formula C23H23N3O8 and a molecular weight of 469.45 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2-ethoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126234651 |
| Molecular Formula | C23H23N3O8 |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-[1-[2-(2-methoxyanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3OC)C2=O)ccc1OCC(=O)O |
| InChI | InChI=1S/C23H23N3O8/c1-3-33-19-11-14(8-9-18(19)34-13-21(28)29)10-16-22(30)26(23(31)25-16)12-20(27)24-15-6-4-5-7-17(15)32-2/h4-11H,3,12-13H2,1-2H3,(H,24,27)(H,25,31)(H,28,29)/b16-10+ |
| InChIKey | AJEAZYQTMZJUTP-MHWRWJLKSA-N |
| XLogP | 2.09 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|