C22H23N3O4 — CID 126238859
2-[(4E)-2,5-dioxo-4-[(2,4,6-trimethylphenyl)methylidene]imidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126238859) has the molecular formula C22H23N3O4 and a molecular weight of 393.44 g/mol. Its IUPAC name is 2-[(4E)-2,5-dioxo-4-[(2,4,6-trimethylphenyl)methylidene]imidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4E)-2,5-dioxo-4-[(2,4,6-trimethylphenyl)methylidene]imidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126238859 |
| Molecular Formula | C22H23N3O4 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 2-[(4E)-2,5-dioxo-4-[(2,4,6-trimethylphenyl)methylidene]imidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2c(C)cc(C)cc2C)C1=O |
| InChI | InChI=1S/C22H23N3O4/c1-13-9-14(2)16(15(3)10-13)11-18-21(27)25(22(28)24-18)12-20(26)23-17-7-5-6-8-19(17)29-4/h5-11H,12H2,1-4H3,(H,23,26)(H,24,28)/b18-11+ |
| InChIKey | BCCSRQLICONXPL-WOJGMQOQSA-N |
| XLogP | 3.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|