C24H20BrN3O5 — CID 126246679
2-[(4Z)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide (PubChem CID 126246679) has the molecular formula C24H20BrN3O5 and a molecular weight of 510.34 g/mol. Its IUPAC name is 2-[(4Z)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[(4Z)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 126246679 |
| Molecular Formula | C24H20BrN3O5 |
| Molecular Weight | 510.34 g/mol |
| Exact Mass | 509.06 |
| IUPAC Name | 2-[(4Z)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN1C(=O)N/C(=C\c2ccc(-c3ccc(C)cc3Br)o2)C1=O |
| InChI | InChI=1S/C24H20BrN3O5/c1-14-7-9-16(17(25)11-14)20-10-8-15(33-20)12-19-23(30)28(24(31)27-19)13-22(29)26-18-5-3-4-6-21(18)32-2/h3-12H,13H2,1-2H3,(H,26,29)(H,27,31)/b19-12- |
| InChIKey | KXJXQIGNWOHFAO-UNOMPAQXSA-N |
| XLogP | 4.56 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|