C24H20BrN3O4 — CID 2301163
2-[(4E)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide (PubChem CID 2301163) has the molecular formula C24H20BrN3O4 and a molecular weight of 494.35 g/mol. Its IUPAC name is 2-[(4E)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 2301163 |
| Molecular Formula | C24H20BrN3O4 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.06 |
| IUPAC Name | 2-[(4E)-4-[[5-(2-bromo-4-methylphenyl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)CN2C(=O)N/C(=C/c3ccc(-c4ccc(C)cc4Br)o3)C2=O)cc1 |
| InChI | InChI=1S/C24H20BrN3O4/c1-14-3-6-16(7-4-14)26-22(29)13-28-23(30)20(27-24(28)31)12-17-8-10-21(32-17)18-9-5-15(2)11-19(18)25/h3-12H,13H2,1-2H3,(H,26,29)(H,27,31)/b20-12+ |
| InChIKey | KOCHFHAAPFJDIT-UDWIEESQSA-N |
| XLogP | 4.86 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|