C23H26N4O4 — CID 126107842
2-[(4E)-4-[[5-(azepan-1-yl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide (PubChem CID 126107842) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 2-[(4E)-4-[[5-(azepan-1-yl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide.
| Compound Name | 2-[(4E)-4-[[5-(azepan-1-yl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126107842 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 2-[(4E)-4-[[5-(azepan-1-yl)furan-2-yl]methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)CN2C(=O)N/C(=C/c3ccc(N4CCCCCC4)o3)C2=O)c1 |
| InChI | InChI=1S/C23H26N4O4/c1-16-7-6-8-17(13-16)24-20(28)15-27-22(29)19(25-23(27)30)14-18-9-10-21(31-18)26-11-4-2-3-5-12-26/h6-10,13-14H,2-5,11-12,15H2,1H3,(H,24,28)(H,25,30)/b19-14+ |
| InChIKey | YNUHRYNXKNQWDS-XMHGGMMESA-N |
| XLogP | 3.50 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|