C21H21FN4O4 — CID 126221060
2-[(4E)-2,5-dioxo-4-[(5-piperidin-1-ylfuran-2-yl)methylidene]imidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126221060) has the molecular formula C21H21FN4O4 and a molecular weight of 412.42 g/mol. Its IUPAC name is 2-[(4E)-2,5-dioxo-4-[(5-piperidin-1-ylfuran-2-yl)methylidene]imidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-2,5-dioxo-4-[(5-piperidin-1-ylfuran-2-yl)methylidene]imidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126221060 |
| Molecular Formula | C21H21FN4O4 |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 2-[(4E)-2,5-dioxo-4-[(5-piperidin-1-ylfuran-2-yl)methylidene]imidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2ccc(N3CCCCC3)o2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H21FN4O4/c22-15-6-2-3-7-16(15)23-18(27)13-26-20(28)17(24-21(26)29)12-14-8-9-19(30-14)25-10-4-1-5-11-25/h2-3,6-9,12H,1,4-5,10-11,13H2,(H,23,27)(H,24,29)/b17-12+ |
| InChIKey | YGCADOGOPJECJL-SFQUDFHCSA-N |
| XLogP | 2.94 |
| TPSA | 94.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|