C21H18FN3O6 — CID 126215807
methyl 2-[2-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126215807) has the molecular formula C21H18FN3O6 and a molecular weight of 427.39 g/mol. Its IUPAC name is methyl 2-[2-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126215807 |
| Molecular Formula | C21H18FN3O6 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | methyl 2-[2-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1ccccc1/C=C1/NC(=O)N(CC(=O)Nc2ccccc2F)C1=O |
| InChI | InChI=1S/C21H18FN3O6/c1-30-19(27)12-31-17-9-5-2-6-13(17)10-16-20(28)25(21(29)24-16)11-18(26)23-15-8-4-3-7-14(15)22/h2-10H,11-12H2,1H3,(H,23,26)(H,24,29)/b16-10+ |
| InChIKey | CSXPAWHOGNRLJT-MHWRWJLKSA-N |
| XLogP | 1.91 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|