C27H23FN4O5 — CID 126206852
N-(2-fluorophenyl)-2-[(4E)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 126206852) has the molecular formula C27H23FN4O5 and a molecular weight of 502.50 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[(4E)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[(4E)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 126206852 |
| Molecular Formula | C27H23FN4O5 |
| Molecular Weight | 502.50 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-(2-fluorophenyl)-2-[(4E)-4-[[2-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | Cc1ccc(NC(=O)COc2ccccc2/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C27H23FN4O5/c1-17-10-12-19(13-11-17)29-25(34)16-37-23-9-5-2-6-18(23)14-22-26(35)32(27(36)31-22)15-24(33)30-21-8-4-3-7-20(21)28/h2-14H,15-16H2,1H3,(H,29,34)(H,30,33)(H,31,36)/b22-14+ |
| InChIKey | IRRMALXZVKBTGA-HYARGMPZSA-N |
| XLogP | 3.68 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|