C23H22IN3O6 — CID 126247445
methyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 126247445) has the molecular formula C23H22IN3O6 and a molecular weight of 563.35 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126247445 |
| Molecular Formula | C23H22IN3O6 |
| Molecular Weight | 563.35 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | methyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | CCc1ccccc1NC(=O)CN1C(=O)N/C(=C/c2ccc(OCC(=O)OC)c(I)c2)C1=O |
| InChI | InChI=1S/C23H22IN3O6/c1-3-15-6-4-5-7-17(15)25-20(28)12-27-22(30)18(26-23(27)31)11-14-8-9-19(16(24)10-14)33-13-21(29)32-2/h4-11H,3,12-13H2,1-2H3,(H,25,28)(H,26,31)/b18-11+ |
| InChIKey | JWILIJHJSPXNNU-WOJGMQOQSA-N |
| XLogP | 2.94 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|