C24H24IN3O6 — CID 126249734
ethyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate (PubChem CID 126249734) has the molecular formula C24H24IN3O6 and a molecular weight of 577.38 g/mol. Its IUPAC name is ethyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate.
| Compound Name | ethyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126249734 |
| Molecular Formula | C24H24IN3O6 |
| Molecular Weight | 577.38 g/mol |
| Exact Mass | 577.07 |
| IUPAC Name | ethyl 2-[4-[(E)-[1-[2-(2-ethylanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodophenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3CC)C2=O)cc1I |
| InChI | InChI=1S/C24H24IN3O6/c1-3-16-7-5-6-8-18(16)26-21(29)13-28-23(31)19(27-24(28)32)12-15-9-10-20(17(25)11-15)34-14-22(30)33-4-2/h5-12H,3-4,13-14H2,1-2H3,(H,26,29)(H,27,32)/b19-12+ |
| InChIKey | SKEOSDXRQIMMFR-XDHOZWIPSA-N |
| XLogP | 3.33 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|