C22H17FN4O5 — CID 126207203
2-[3-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid (PubChem CID 126207203) has the molecular formula C22H17FN4O5 and a molecular weight of 436.40 g/mol. Its IUPAC name is 2-[3-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid.
| Compound Name | 2-[3-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid |
|---|---|
| PubChem CID | 126207203 |
| Molecular Formula | C22H17FN4O5 |
| Molecular Weight | 436.40 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-[3-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]indol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)c2ccccc21 |
| InChI | InChI=1S/C22H17FN4O5/c23-15-6-2-3-7-16(15)24-19(28)11-27-21(31)17(25-22(27)32)9-13-10-26(12-20(29)30)18-8-4-1-5-14(13)18/h1-10H,11-12H2,(H,24,28)(H,25,32)(H,29,30)/b17-9+ |
| InChIKey | KYZJVXYARJZMQP-RQZCQDPDSA-N |
| XLogP | 2.40 |
| TPSA | 120.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|