C16H11BrFN3O3S — CID 126218386
2-[(4E)-4-[(4-bromothiophen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide (PubChem CID 126218386) has the molecular formula C16H11BrFN3O3S and a molecular weight of 424.25 g/mol. Its IUPAC name is 2-[(4E)-4-[(4-bromothiophen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide.
| Compound Name | 2-[(4E)-4-[(4-bromothiophen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 126218386 |
| Molecular Formula | C16H11BrFN3O3S |
| Molecular Weight | 424.25 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | 2-[(4E)-4-[(4-bromothiophen-2-yl)methylidene]-2,5-dioxoimidazolidin-1-yl]-N-(2-fluorophenyl)acetamide |
| SMILES | O=C(CN1C(=O)N/C(=C/c2cc(Br)cs2)C1=O)Nc1ccccc1F |
| InChI | InChI=1S/C16H11BrFN3O3S/c17-9-5-10(25-8-9)6-13-15(23)21(16(24)20-13)7-14(22)19-12-4-2-1-3-11(12)18/h1-6,8H,7H2,(H,19,22)(H,20,24)/b13-6+ |
| InChIKey | NRENHGJCXUFIBD-AWNIVKPZSA-N |
| XLogP | 3.18 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.25 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|