C20H14Br2FN3O6 — CID 126218191
2-[2,6-dibromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 126218191) has the molecular formula C20H14Br2FN3O6 and a molecular weight of 571.15 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 126218191 |
| Molecular Formula | C20H14Br2FN3O6 |
| Molecular Weight | 571.15 g/mol |
| Exact Mass | 568.92 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[1-[2-(2-fluoroanilino)-2-oxoethyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2/NC(=O)N(CC(=O)Nc3ccccc3F)C2=O)cc1Br |
| InChI | InChI=1S/C20H14Br2FN3O6/c21-11-5-10(6-12(22)18(11)32-9-17(28)29)7-15-19(30)26(20(31)25-15)8-16(27)24-14-4-2-1-3-13(14)23/h1-7H,8-9H2,(H,24,27)(H,25,31)(H,28,29)/b15-7+ |
| InChIKey | PADYLHMNUVRGES-VIZOYTHASA-N |
| XLogP | 3.35 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|