C19H14Br2N2O5 — CID 5453170
2-[4-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-dibromophenoxy]acetic acid (PubChem CID 5453170) has the molecular formula C19H14Br2N2O5 and a molecular weight of 510.14 g/mol. Its IUPAC name is 2-[4-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-dibromophenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-dibromophenoxy]acetic acid |
|---|---|
| PubChem CID | 5453170 |
| Molecular Formula | C19H14Br2N2O5 |
| Molecular Weight | 510.14 g/mol |
| Exact Mass | 507.93 |
| IUPAC Name | 2-[4-[(Z)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2,6-dibromophenoxy]acetic acid |
| SMILES | O=C(O)COc1c(Br)cc(/C=C2\NC(=O)N(Cc3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C19H14Br2N2O5/c20-13-6-12(7-14(21)17(13)28-10-16(24)25)8-15-18(26)23(19(27)22-15)9-11-4-2-1-3-5-11/h1-8H,9-10H2,(H,22,27)(H,24,25)/b15-8- |
| InChIKey | FROLAIJBRYCYEL-NVNXTCNLSA-N |
| XLogP | 3.77 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.14 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|