C20H15BrClFN2O5 — CID 126020314
methyl 2-[2-bromo-6-chloro-4-[(E)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 126020314) has the molecular formula C20H15BrClFN2O5 and a molecular weight of 497.70 g/mol. Its IUPAC name is methyl 2-[2-bromo-6-chloro-4-[(E)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-bromo-6-chloro-4-[(E)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126020314 |
| Molecular Formula | C20H15BrClFN2O5 |
| Molecular Weight | 497.70 g/mol |
| Exact Mass | 495.98 |
| IUPAC Name | methyl 2-[2-bromo-6-chloro-4-[(E)-[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=C2/NC(=O)N(Cc3ccc(F)cc3)C2=O)cc1Br |
| InChI | InChI=1S/C20H15BrClFN2O5/c1-29-17(26)10-30-18-14(21)6-12(7-15(18)22)8-16-19(27)25(20(28)24-16)9-11-2-4-13(23)5-3-11/h2-8H,9-10H2,1H3,(H,24,28)/b16-8+ |
| InChIKey | NUIRTQCCBJOIQF-LZYBPNLTSA-N |
| XLogP | 3.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.70 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|