C20H16BrClN2O5 — CID 126238997
methyl 2-[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-chlorophenoxy]acetate (PubChem CID 126238997) has the molecular formula C20H16BrClN2O5 and a molecular weight of 479.71 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-chlorophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-chlorophenoxy]acetate |
|---|---|
| PubChem CID | 126238997 |
| Molecular Formula | C20H16BrClN2O5 |
| Molecular Weight | 479.71 g/mol |
| Exact Mass | 477.99 |
| IUPAC Name | methyl 2-[4-[(E)-(1-benzyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-bromo-6-chlorophenoxy]acetate |
| SMILES | COC(=O)COc1c(Cl)cc(/C=C2/NC(=O)N(Cc3ccccc3)C2=O)cc1Br |
| InChI | InChI=1S/C20H16BrClN2O5/c1-28-17(25)11-29-18-14(21)7-13(8-15(18)22)9-16-19(26)24(20(27)23-16)10-12-5-3-2-4-6-12/h2-9H,10-11H2,1H3,(H,23,27)/b16-9+ |
| InChIKey | QFUGOZOAPVKUCN-CXUHLZMHSA-N |
| XLogP | 3.75 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.71 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|