C21H17Cl2FN2O5 — CID 2930068
ethyl 2-[2,6-dichloro-4-[[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate (PubChem CID 2930068) has the molecular formula C21H17Cl2FN2O5 and a molecular weight of 467.28 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 2930068 |
| Molecular Formula | C21H17Cl2FN2O5 |
| Molecular Weight | 467.28 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[[1-[(4-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=C2NC(=O)N(Cc3ccc(F)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C21H17Cl2FN2O5/c1-2-30-18(27)11-31-19-15(22)7-13(8-16(19)23)9-17-20(28)26(21(29)25-17)10-12-3-5-14(24)6-4-12/h3-9H,2,10-11H2,1H3,(H,25,29) |
| InChIKey | IOHYRCBXVIDXGU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.28 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|