C23H22BrClN2O6 — CID 3421212
ethyl 2-[4-[[1-[(4-bromophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-chloro-6-ethoxyphenoxy]acetate (PubChem CID 3421212) has the molecular formula C23H22BrClN2O6 and a molecular weight of 537.79 g/mol. Its IUPAC name is ethyl 2-[4-[[1-[(4-bromophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-chloro-6-ethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[1-[(4-bromophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-chloro-6-ethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 3421212 |
| Molecular Formula | C23H22BrClN2O6 |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 536.03 |
| IUPAC Name | ethyl 2-[4-[[1-[(4-bromophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-chloro-6-ethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=C2NC(=O)N(Cc3ccc(Br)cc3)C2=O)cc1OCC |
| InChI | InChI=1S/C23H22BrClN2O6/c1-3-31-19-11-15(9-17(25)21(19)33-13-20(28)32-4-2)10-18-22(29)27(23(30)26-18)12-14-5-7-16(24)8-6-14/h5-11H,3-4,12-13H2,1-2H3,(H,26,30) |
| InChIKey | PRFCRADYSZLLHZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|