C18H19ClN2O6 — CID 126130724
ethyl 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetate (PubChem CID 126130724) has the molecular formula C18H19ClN2O6 and a molecular weight of 394.81 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126130724 |
| Molecular Formula | C18H19ClN2O6 |
| Molecular Weight | 394.81 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetate |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc(Cl)c(OCC(=O)OCC)c(OC)c2)C1=O |
| InChI | InChI=1S/C18H19ClN2O6/c1-4-6-21-17(23)13(20-18(21)24)8-11-7-12(19)16(14(9-11)25-3)27-10-15(22)26-5-2/h4,7-9H,1,5-6,10H2,2-3H3,(H,20,24)/b13-8+ |
| InChIKey | HMTPCRLDAITDQP-MDWZMJQESA-N |
| XLogP | 2.37 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.81 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|