C17H17ClN2O6 — CID 126143627
2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetic acid (PubChem CID 126143627) has the molecular formula C17H17ClN2O6 and a molecular weight of 380.78 g/mol. Its IUPAC name is 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 126143627 |
| Molecular Formula | C17H17ClN2O6 |
| Molecular Weight | 380.78 g/mol |
| Exact Mass | 380.08 |
| IUPAC Name | 2-[2-chloro-4-[(E)-(2,5-dioxo-1-prop-2-enylimidazolidin-4-ylidene)methyl]-6-ethoxyphenoxy]acetic acid |
| SMILES | C=CCN1C(=O)N/C(=C/c2cc(Cl)c(OCC(=O)O)c(OCC)c2)C1=O |
| InChI | InChI=1S/C17H17ClN2O6/c1-3-5-20-16(23)12(19-17(20)24)7-10-6-11(18)15(26-9-14(21)22)13(8-10)25-4-2/h3,6-8H,1,4-5,9H2,2H3,(H,19,24)(H,21,22)/b12-7+ |
| InChIKey | VTLNGQHUEVEVTD-KPKJPENVSA-N |
| XLogP | 2.28 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.78 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|