C16H19ClN2O4 — CID 126251789
(5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126251789) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126251789 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | (5E)-5-[(3-chloro-4,5-diethoxyphenyl)methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(CC)C2=O)cc(Cl)c1OCC |
| InChI | InChI=1S/C16H19ClN2O4/c1-4-19-15(20)12(18-16(19)21)8-10-7-11(17)14(23-6-3)13(9-10)22-5-2/h7-9H,4-6H2,1-3H3,(H,18,21)/b12-8+ |
| InChIKey | WLZMDDWECWWHII-XYOKQWHBSA-N |
| XLogP | 3.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|