C15H16Cl2N2O3 — CID 126242522
(5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione (PubChem CID 126242522) has the molecular formula C15H16Cl2N2O3 and a molecular weight of 343.21 g/mol. Its IUPAC name is (5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126242522 |
| Molecular Formula | C15H16Cl2N2O3 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (5E)-5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-propylimidazolidine-2,4-dione |
| SMILES | CCCN1C(=O)N/C(=C/c2cc(Cl)c(OCC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H16Cl2N2O3/c1-3-5-19-14(20)12(18-15(19)21)8-9-6-10(16)13(22-4-2)11(17)7-9/h6-8H,3-5H2,1-2H3,(H,18,21)/b12-8+ |
| InChIKey | DZHVPFYIPPUBHY-XYOKQWHBSA-N |
| XLogP | 3.69 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|