C18H14Cl2N2O3 — CID 4272376
5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 4272376) has the molecular formula C18H14Cl2N2O3 and a molecular weight of 377.23 g/mol. Its IUPAC name is 5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | 5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4272376 |
| Molecular Formula | C18H14Cl2N2O3 |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 5-[(3,5-dichloro-4-ethoxyphenyl)methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | CCOc1c(Cl)cc(C=C2NC(=O)N(c3ccccc3)C2=O)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O3/c1-2-25-16-13(19)8-11(9-14(16)20)10-15-17(23)22(18(24)21-15)12-6-4-3-5-7-12/h3-10H,2H2,1H3,(H,21,24) |
| InChIKey | LGQZFRNYAGWGAJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|