C19H15ClN2O6 — CID 6518927
2-[2-chloro-4-[(Z)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid (PubChem CID 6518927) has the molecular formula C19H15ClN2O6 and a molecular weight of 402.79 g/mol. Its IUPAC name is 2-[2-chloro-4-[(Z)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid.
| Compound Name | 2-[2-chloro-4-[(Z)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 6518927 |
| Molecular Formula | C19H15ClN2O6 |
| Molecular Weight | 402.79 g/mol |
| Exact Mass | 402.06 |
| IUPAC Name | 2-[2-chloro-4-[(Z)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]-6-methoxyphenoxy]acetic acid |
| SMILES | COc1cc(/C=C2\NC(=O)N(c3ccccc3)C2=O)cc(Cl)c1OCC(=O)O |
| InChI | InChI=1S/C19H15ClN2O6/c1-27-15-9-11(7-13(20)17(15)28-10-16(23)24)8-14-18(25)22(19(26)21-14)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H,21,26)(H,23,24)/b14-8- |
| InChIKey | QCPLSPOAWWZMJX-ZSOIEALJSA-N |
| XLogP | 2.91 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.79 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|