C25H19Cl3N2O4 — CID 126027324
(5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione (PubChem CID 126027324) has the molecular formula C25H19Cl3N2O4 and a molecular weight of 517.80 g/mol. Its IUPAC name is (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126027324 |
| Molecular Formula | C25H19Cl3N2O4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | (5E)-5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-3-phenylimidazolidine-2,4-dione |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(c3ccccc3)C2=O)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C25H19Cl3N2O4/c1-2-33-22-13-16(11-20(28)23(22)34-14-15-8-9-18(26)19(27)10-15)12-21-24(31)30(25(32)29-21)17-6-4-3-5-7-17/h3-13H,2,14H2,1H3,(H,29,32)/b21-12+ |
| InChIKey | SSNYQUFKUVXBJR-CIAFOILYSA-N |
| XLogP | 6.72 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|