C26H19Cl3N2O6 — CID 2892797
5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 2892797) has the molecular formula C26H19Cl3N2O6 and a molecular weight of 561.81 g/mol. Its IUPAC name is 5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2892797 |
| Molecular Formula | C26H19Cl3N2O6 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 560.03 |
| IUPAC Name | 5-[[3-chloro-4-[(3,4-dichlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-1-(4-hydroxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1cc(C=C2C(=O)NC(=O)N(c3ccc(O)cc3)C2=O)cc(Cl)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19Cl3N2O6/c1-2-36-22-12-15(11-21(29)23(22)37-13-14-3-8-19(27)20(28)10-14)9-18-24(33)30-26(35)31(25(18)34)16-4-6-17(32)7-5-16/h3-12,32H,2,13H2,1H3,(H,30,33,35) |
| InChIKey | UQWTWWCBSGVMLM-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|