C20H16ClIN2O6 — CID 126247576
2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetic acid (PubChem CID 126247576) has the molecular formula C20H16ClIN2O6 and a molecular weight of 542.71 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetic acid |
|---|---|
| PubChem CID | 126247576 |
| Molecular Formula | C20H16ClIN2O6 |
| Molecular Weight | 542.71 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2-[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(I)c1OCC(=O)O |
| InChI | InChI=1S/C20H16ClIN2O6/c1-2-29-16-9-11(7-14(22)18(16)30-10-17(25)26)8-15-19(27)24(20(28)23-15)13-5-3-12(21)4-6-13/h3-9H,2,10H2,1H3,(H,23,28)(H,25,26)/b15-8+ |
| InChIKey | SHHHSRDDKYDZFZ-OVCLIPMQSA-N |
| XLogP | 3.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.71 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|