C25H18ClIN2O6 — CID 126178535
4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid (PubChem CID 126178535) has the molecular formula C25H18ClIN2O6 and a molecular weight of 604.78 g/mol. Its IUPAC name is 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126178535 |
| Molecular Formula | C25H18ClIN2O6 |
| Molecular Weight | 604.78 g/mol |
| Exact Mass | 603.99 |
| IUPAC Name | 4-[[4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]methyl]benzoic acid |
| SMILES | COc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(I)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C25H18ClIN2O6/c1-34-21-12-15(10-19(27)22(21)35-13-14-2-4-16(5-3-14)24(31)32)11-20-23(30)29(25(33)28-20)18-8-6-17(26)7-9-18/h2-12H,13H2,1H3,(H,28,33)(H,31,32)/b20-11+ |
| InChIKey | FLGXUNPZBGBKII-RGVLZGJSSA-N |
| XLogP | 5.33 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.78 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|