C26H20BrClN2O6 — CID 126173726
4-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid (PubChem CID 126173726) has the molecular formula C26H20BrClN2O6 and a molecular weight of 571.81 g/mol. Its IUPAC name is 4-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid.
| Compound Name | 4-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126173726 |
| Molecular Formula | C26H20BrClN2O6 |
| Molecular Weight | 571.81 g/mol |
| Exact Mass | 570.02 |
| IUPAC Name | 4-[[2-bromo-4-[(E)-[1-(4-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]-6-ethoxyphenoxy]methyl]benzoic acid |
| SMILES | CCOc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(Br)c1OCc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H20BrClN2O6/c1-2-35-22-13-16(11-20(27)23(22)36-14-15-3-5-17(6-4-15)25(32)33)12-21-24(31)30(26(34)29-21)19-9-7-18(28)8-10-19/h3-13H,2,14H2,1H3,(H,29,34)(H,32,33)/b21-12+ |
| InChIKey | LDQJJLIXUFKRKP-CIAFOILYSA-N |
| XLogP | 5.88 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.81 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|