C24H18BrClN2O4 — CID 126179428
(5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione (PubChem CID 126179428) has the molecular formula C24H18BrClN2O4 and a molecular weight of 513.78 g/mol. Its IUPAC name is (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione.
| Compound Name | (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126179428 |
| Molecular Formula | C24H18BrClN2O4 |
| Molecular Weight | 513.78 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | (5E)-5-[(3-bromo-5-methoxy-4-phenylmethoxyphenyl)methylidene]-3-(4-chlorophenyl)imidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/NC(=O)N(c3ccc(Cl)cc3)C2=O)cc(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H18BrClN2O4/c1-31-21-13-16(11-19(25)22(21)32-14-15-5-3-2-4-6-15)12-20-23(29)28(24(30)27-20)18-9-7-17(26)8-10-18/h2-13H,14H2,1H3,(H,27,30)/b20-12+ |
| InChIKey | LAXXFVSSLMCQSP-UDWIEESQSA-N |
| XLogP | 5.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.78 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|