C20H18BrClN2O4 — CID 126178544
(5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethylimidazolidine-2,4-dione (PubChem CID 126178544) has the molecular formula C20H18BrClN2O4 and a molecular weight of 465.73 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126178544 |
| Molecular Formula | C20H18BrClN2O4 |
| Molecular Weight | 465.73 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-ethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(OC)c2)C1=O |
| InChI | InChI=1S/C20H18BrClN2O4/c1-3-24-19(25)16(23-20(24)26)9-13-8-15(21)18(17(10-13)27-2)28-11-12-4-6-14(22)7-5-12/h4-10H,3,11H2,1-2H3,(H,23,26)/b16-9+ |
| InChIKey | FPMWLBXOZJMFAF-CXUHLZMHSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.73 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|