C21H18BrClN2O5 — CID 50884149
5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 50884149) has the molecular formula C21H18BrClN2O5 and a molecular weight of 493.74 g/mol. Its IUPAC name is 5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 50884149 |
| Molecular Formula | C21H18BrClN2O5 |
| Molecular Weight | 493.74 g/mol |
| Exact Mass | 492.01 |
| IUPAC Name | 5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(C=C2C(=O)N(C)C(=O)N(C)C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H18BrClN2O5/c1-24-19(26)15(20(27)25(2)21(24)28)8-13-9-16(22)18(17(10-13)29-3)30-11-12-4-6-14(23)7-5-12/h4-10H,11H2,1-3H3 |
| InChIKey | NKQUUEWBKVRAID-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.74 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|