C21H17BrClNO5S2 — CID 19198454
3-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 19198454) has the molecular formula C21H17BrClNO5S2 and a molecular weight of 542.86 g/mol. Its IUPAC name is 3-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 19198454 |
| Molecular Formula | C21H17BrClNO5S2 |
| Molecular Weight | 542.86 g/mol |
| Exact Mass | 540.94 |
| IUPAC Name | 3-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCC(=O)O)C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17BrClNO5S2/c1-28-16-9-13(10-17-20(27)24(21(30)31-17)7-6-18(25)26)8-15(22)19(16)29-11-12-2-4-14(23)5-3-12/h2-5,8-10H,6-7,11H2,1H3,(H,25,26)/b17-10- |
| InChIKey | HHFBPFGYSDKUCS-YVLHZVERSA-N |
| XLogP | 5.37 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.86 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|