C24H23BrClNO5S2 — CID 19195738
6-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 19195738) has the molecular formula C24H23BrClNO5S2 and a molecular weight of 584.94 g/mol. Its IUPAC name is 6-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 19195738 |
| Molecular Formula | C24H23BrClNO5S2 |
| Molecular Weight | 584.94 g/mol |
| Exact Mass | 582.99 |
| IUPAC Name | 6-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCCCCC(=O)O)C2=O)cc(Br)c1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H23BrClNO5S2/c1-31-19-12-16(11-18(25)22(19)32-14-15-6-8-17(26)9-7-15)13-20-23(30)27(24(33)34-20)10-4-2-3-5-21(28)29/h6-9,11-13H,2-5,10,14H2,1H3,(H,28,29)/b20-13- |
| InChIKey | HFNYZCDRRKBQPQ-MOSHPQCFSA-N |
| XLogP | 6.54 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.94 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|