C28H32BrNO5S2 — CID 19199350
ethyl 4-[(5E)-5-[[3-bromo-4-[(4-tert-butylphenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199350) has the molecular formula C28H32BrNO5S2 and a molecular weight of 606.60 g/mol. Its IUPAC name is ethyl 4-[(5E)-5-[[3-bromo-4-[(4-tert-butylphenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5E)-5-[[3-bromo-4-[(4-tert-butylphenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199350 |
| Molecular Formula | C28H32BrNO5S2 |
| Molecular Weight | 606.60 g/mol |
| Exact Mass | 605.09 |
| IUPAC Name | ethyl 4-[(5E)-5-[[3-bromo-4-[(4-tert-butylphenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccc(C(C)(C)C)cc3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C28H32BrNO5S2/c1-6-34-24(31)8-7-13-30-26(32)23(37-27(30)36)16-19-14-21(29)25(22(15-19)33-5)35-17-18-9-11-20(12-10-18)28(2,3)4/h9-12,14-16H,6-8,13,17H2,1-5H3/b23-16+ |
| InChIKey | RGVFWPMNARRZBV-XQNSMLJCSA-N |
| XLogP | 6.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|