C30H37NO5S2 — CID 19196094
ethyl 6-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19196094) has the molecular formula C30H37NO5S2 and a molecular weight of 555.76 g/mol. Its IUPAC name is ethyl 6-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | ethyl 6-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19196094 |
| Molecular Formula | C30H37NO5S2 |
| Molecular Weight | 555.76 g/mol |
| Exact Mass | 555.21 |
| IUPAC Name | ethyl 6-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)/C(=C\c2ccc(OCc3ccc(C(C)(C)C)cc3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C30H37NO5S2/c1-6-35-27(32)10-8-7-9-17-31-28(33)26(38-29(31)37)19-22-13-16-24(25(18-22)34-5)36-20-21-11-14-23(15-12-21)30(2,3)4/h11-16,18-19H,6-10,17,20H2,1-5H3/b26-19+ |
| InChIKey | WSEGPAJHYKTIAI-LGUFXXKBSA-N |
| XLogP | 6.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.76 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|