C22H20NO5S2- — CID 5122704
3-[5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 5122704) has the molecular formula C22H20NO5S2- and a molecular weight of 442.54 g/mol. Its IUPAC name is 3-[5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | 3-[5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 5122704 |
| Molecular Formula | C22H20NO5S2- |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 3-[5-[[3-methoxy-4-[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | COc1cc(C=C2SC(=S)N(CCC(=O)[O-])C2=O)ccc1OCc1ccc(C)cc1 |
| InChI | InChI=1S/C22H21NO5S2/c1-14-3-5-15(6-4-14)13-28-17-8-7-16(11-18(17)27-2)12-19-21(26)23(22(29)30-19)10-9-20(24)25/h3-8,11-12H,9-10,13H2,1-2H3,(H,24,25)/p-1 |
| InChIKey | FOKDBSIPVQNVEY-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|