C28H33NO5S2 — CID 19198811
ethyl 3-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 19198811) has the molecular formula C28H33NO5S2 and a molecular weight of 527.71 g/mol. Its IUPAC name is ethyl 3-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | ethyl 3-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 19198811 |
| Molecular Formula | C28H33NO5S2 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | ethyl 3-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCOC(=O)CCN1C(=O)/C(=C\c2ccc(OCc3ccc(C(C)(C)C)cc3)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C28H33NO5S2/c1-6-32-23-16-20(17-24-26(31)29(27(35)36-24)15-14-25(30)33-7-2)10-13-22(23)34-18-19-8-11-21(12-9-19)28(3,4)5/h8-13,16-17H,6-7,14-15,18H2,1-5H3/b24-17+ |
| InChIKey | QCZCEYAIORHAGC-JJIBRWJFSA-N |
| XLogP | 6.12 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|