C20H25NO3S2 — CID 19182630
propyl 3-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 19182630) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is propyl 3-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | propyl 3-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 19182630 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | propyl 3-[(5Z)-5-[(4-tert-butylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | CCCOC(=O)CCN1C(=O)/C(=C/c2ccc(C(C)(C)C)cc2)SC1=S |
| InChI | InChI=1S/C20H25NO3S2/c1-5-12-24-17(22)10-11-21-18(23)16(26-19(21)25)13-14-6-8-15(9-7-14)20(2,3)4/h6-9,13H,5,10-12H2,1-4H3/b16-13- |
| InChIKey | LSPLGQJUEGSYBN-SSZFMOIBSA-N |
| XLogP | 4.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|