C19H23NO4S2 — CID 19182503
ethyl 4-[(5Z)-4-oxo-5-[(4-propoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19182503) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl 4-[(5Z)-4-oxo-5-[(4-propoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5Z)-4-oxo-5-[(4-propoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19182503 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl 4-[(5Z)-4-oxo-5-[(4-propoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOc1ccc(/C=C2\SC(=S)N(CCCC(=O)OCC)C2=O)cc1 |
| InChI | InChI=1S/C19H23NO4S2/c1-3-12-24-15-9-7-14(8-10-15)13-16-18(22)20(19(25)26-16)11-5-6-17(21)23-4-2/h7-10,13H,3-6,11-12H2,1-2H3/b16-13- |
| InChIKey | ZGDFACREQCYBKK-SSZFMOIBSA-N |
| XLogP | 4.02 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|