C24H24BrNO4S2 — CID 19199618
propyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199618) has the molecular formula C24H24BrNO4S2 and a molecular weight of 534.50 g/mol. Its IUPAC name is propyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199618 |
| Molecular Formula | C24H24BrNO4S2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | propyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C\c2ccc(OCc3cccc(Br)c3)cc2)SC1=S |
| InChI | InChI=1S/C24H24BrNO4S2/c1-2-13-29-22(27)7-4-12-26-23(28)21(32-24(26)31)15-17-8-10-20(11-9-17)30-16-18-5-3-6-19(25)14-18/h3,5-6,8-11,14-15H,2,4,7,12-13,16H2,1H3/b21-15+ |
| InChIKey | QANMGCFVMVLDFH-RCCKNPSSSA-N |
| XLogP | 5.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|