C23H22BrNO4S2 — CID 19199417
ethyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199417) has the molecular formula C23H22BrNO4S2 and a molecular weight of 520.47 g/mol. Its IUPAC name is ethyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199417 |
| Molecular Formula | C23H22BrNO4S2 |
| Molecular Weight | 520.47 g/mol |
| Exact Mass | 519.02 |
| IUPAC Name | ethyl 4-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C\c2ccc(OCc3cccc(Br)c3)cc2)SC1=S |
| InChI | InChI=1S/C23H22BrNO4S2/c1-2-28-21(26)7-4-12-25-22(27)20(31-23(25)30)14-16-8-10-19(11-9-16)29-15-17-5-3-6-18(24)13-17/h3,5-6,8-11,13-14H,2,4,7,12,15H2,1H3/b20-14+ |
| InChIKey | VNDWTHFSFMJDKL-XSFVSMFZSA-N |
| XLogP | 5.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|