C25H27NO4S2 — CID 19196065
ethyl 6-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19196065) has the molecular formula C25H27NO4S2 and a molecular weight of 469.63 g/mol. Its IUPAC name is ethyl 6-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | ethyl 6-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19196065 |
| Molecular Formula | C25H27NO4S2 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | ethyl 6-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C25H27NO4S2/c1-2-29-23(27)11-7-4-8-16-26-24(28)22(32-25(26)31)17-19-12-14-21(15-13-19)30-18-20-9-5-3-6-10-20/h3,5-6,9-10,12-15,17H,2,4,7-8,11,16,18H2,1H3/b22-17- |
| InChIKey | YWUPRPOPYGBXFW-XLNRJJMWSA-N |
| XLogP | 5.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|